C23H27N2O2+ — CID 145050779
6-(5,11-dimethyl-7,8-dihydro-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)hexanoic acid (PubChem CID 145050779) has the molecular formula C23H27N2O2+ and a molecular weight of 363.48 g/mol. Its IUPAC name is 6-(5,11-dimethyl-7,8-dihydro-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)hexanoic acid.
| Compound Name | 6-(5,11-dimethyl-7,8-dihydro-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 145050779 |
| Molecular Formula | C23H27N2O2+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 6-(5,11-dimethyl-7,8-dihydro-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)hexanoic acid |
| SMILES | Cc1c2cc[n+](CCCCCC(=O)O)cc2c(C)c2c3c([nH]c12)CCC=C3 |
| InChI | InChI=1S/C23H26N2O2/c1-15-19-14-25(12-7-3-4-10-21(26)27)13-11-17(19)16(2)23-22(15)18-8-5-6-9-20(18)24-23/h5,8,11,13-14H,3-4,6-7,9-10,12H2,1-2H3,(H,26,27)/p+1 |
| InChIKey | MAQHGOIXMMFELH-UHFFFAOYSA-O |
| XLogP | 4.83 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|