C21H20ClN3 — CID 70676740
4-(5,11-dimethyl-10H-pyrido[3,4-b]carbazol-2-ium-2-yl)butanenitrile chloride (PubChem CID 70676740) has the molecular formula C21H20ClN3 and a molecular weight of 349.87 g/mol. Its IUPAC name is 4-(5,11-dimethyl-10H-pyrido[3,4-b]carbazol-2-ium-2-yl)butanenitrile chloride.
| Compound Name | 4-(5,11-dimethyl-10H-pyrido[3,4-b]carbazol-2-ium-2-yl)butanenitrile chloride |
|---|---|
| PubChem CID | 70676740 |
| Molecular Formula | C21H20ClN3 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-(5,11-dimethyl-10H-pyrido[3,4-b]carbazol-2-ium-2-yl)butanenitrile chloride |
| SMILES | Cc1c2c[n+](CCCC#N)ccc2c(C)c2c1[nH]c1ccccc12.[Cl-] |
| InChI | InChI=1S/C21H19N3.ClH/c1-14-16-9-12-24(11-6-5-10-22)13-18(16)15(2)21-20(14)17-7-3-4-8-19(17)23-21;/h3-4,7-9,12-13H,5-6,11H2,1-2H3;1H |
| InChIKey | USHYMHKOELQFHI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|