C21H24N3O+ — CID 90682276
2-[2-(5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)ethoxy]ethanamine (PubChem CID 90682276) has the molecular formula C21H24N3O+ and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-[2-(5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)ethoxy]ethanamine.
| Compound Name | 2-[2-(5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 90682276 |
| Molecular Formula | C21H24N3O+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-[2-(5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)ethoxy]ethanamine |
| SMILES | Cc1c2cc[n+](CCOCCN)cc2c(C)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C21H23N3O/c1-14-18-13-24(10-12-25-11-8-22)9-7-16(18)15(2)21-20(14)17-5-3-4-6-19(17)23-21/h3-7,9,13H,8,10-12,22H2,1-2H3/p+1 |
| InChIKey | PFNWPBFEFAYXKO-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 54.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|