C22H25N4O2+ — CID 134149656
N-[2-(2-aminoethoxy)ethyl]-2,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide (PubChem CID 134149656) has the molecular formula C22H25N4O2+ and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-2,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-2,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide |
|---|---|
| PubChem CID | 134149656 |
| Molecular Formula | C22H25N4O2+ |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-2,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide |
| SMILES | Cc1c2c[n+](C)ccc2c(C(=O)NCCOCCN)c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C22H24N4O2/c1-14-17-13-26(2)10-7-15(17)20(22(27)24-9-12-28-11-8-23)21-19(14)16-5-3-4-6-18(16)25-21/h3-7,10,13H,8-9,11-12,23H2,1-2H3,(H,24,27)/p+1 |
| InChIKey | DEWRVIILPCIJLE-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|