C21H23ClN4O — CID 134156652
N-(3-aminopropyl)-2,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide chloride (PubChem CID 134156652) has the molecular formula C21H23ClN4O and a molecular weight of 382.90 g/mol. Its IUPAC name is N-(3-aminopropyl)-2,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide chloride.
| Compound Name | N-(3-aminopropyl)-2,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide chloride |
|---|---|
| PubChem CID | 134156652 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-(3-aminopropyl)-2,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide chloride |
| SMILES | Cc1c2c[n+](C)ccc2c(C(=O)NCCCN)c2[nH]c3ccccc3c12.[Cl-] |
| InChI | InChI=1S/C21H22N4O.ClH/c1-13-16-12-25(2)11-8-14(16)19(21(26)23-10-5-9-22)20-18(13)15-6-3-4-7-17(15)24-20;/h3-4,6-8,11-12H,5,9-10,22H2,1-2H3,(H,23,26);1H |
| InChIKey | DAEBGGTXHVAWHJ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|