C24H27N4O4+ — CID 134139601
methyl 11-methyl-2-[2-[2-(methylcarbamoylamino)ethoxy]ethyl]-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxylate (PubChem CID 134139601) has the molecular formula C24H27N4O4+ and a molecular weight of 435.50 g/mol. Its IUPAC name is methyl 11-methyl-2-[2-[2-(methylcarbamoylamino)ethoxy]ethyl]-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxylate.
| Compound Name | methyl 11-methyl-2-[2-[2-(methylcarbamoylamino)ethoxy]ethyl]-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxylate |
|---|---|
| PubChem CID | 134139601 |
| Molecular Formula | C24H27N4O4+ |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | methyl 11-methyl-2-[2-[2-(methylcarbamoylamino)ethoxy]ethyl]-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxylate |
| SMILES | CNC(=O)NCCOCC[n+]1ccc2c(C(=O)OC)c3[nH]c4ccccc4c3c(C)c2c1 |
| InChI | InChI=1S/C24H26N4O4/c1-15-18-14-28(11-13-32-12-9-26-24(30)25-2)10-8-16(18)21(23(29)31-3)22-20(15)17-6-4-5-7-19(17)27-22/h4-8,10,14H,9,11-13H2,1-3H3,(H2,25,26,30)/p+1 |
| InChIKey | XPCUWXPMOSNYDK-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|