C22H25N5O2 — CID 12000778
5,11-dimethyl-N-[2-(methylcarbamoylamino)ethyl]-1,6-dihydropyrido[4,3-b]carbazole-2-carboxamide (PubChem CID 12000778) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 5,11-dimethyl-N-[2-(methylcarbamoylamino)ethyl]-1,6-dihydropyrido[4,3-b]carbazole-2-carboxamide.
| Compound Name | 5,11-dimethyl-N-[2-(methylcarbamoylamino)ethyl]-1,6-dihydropyrido[4,3-b]carbazole-2-carboxamide |
|---|---|
| PubChem CID | 12000778 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 5,11-dimethyl-N-[2-(methylcarbamoylamino)ethyl]-1,6-dihydropyrido[4,3-b]carbazole-2-carboxamide |
| SMILES | CNC(=O)NCCNC(=O)N1C=Cc2c(c(C)c3c([nH]c4ccccc43)c2C)C1 |
| InChI | InChI=1S/C22H25N5O2/c1-13-17-12-27(22(29)25-10-9-24-21(28)23-3)11-8-15(17)14(2)20-19(13)16-6-4-5-7-18(16)26-20/h4-8,11,26H,9-10,12H2,1-3H3,(H,25,29)(H2,23,24,28) |
| InChIKey | DCCSQRSGTMEYPE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|