About 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride
5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride (PubChem CID 5351320) has the molecular formula C18H16ClN3O
and a molecular weight of 325.80 g/mol. Its IUPAC name is 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride |
| PubChem CID | 5351320 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride |
| SMILES | Cc1c2ccnc(C(N)=O)c2c(C)c2c1[nH]c1ccccc12.Cl |
| InChI | InChI=1S/C18H15N3O.ClH/c1-9-11-7-8-20-17(18(19)22)14(11)10(2)15-12-5-3-4-6-13(12)21-16(9)15;/h3-8,21H,1-2H3,(H2,19,22);1H |
| InChIKey | KYNQVALQBVIVGA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride?
The IUPAC name of 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride (CID 5351320) is 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride.
What is the SMILES notation for 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride?
The canonical SMILES for 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride is Cc1c2ccnc(C(N)=O)c2c(C)c2c1[nH]c1ccccc12.Cl.
What is the InChIKey of 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride?
The InChIKey is KYNQVALQBVIVGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O.ClH/c1-9-11-7-8-20-17(18(19)22)14(11)10(2)15-12-5-3-4-6-13(12)21-16(9)15;/h3-8,21H,1-2H3,(H2,19,22);1H.
What are the key properties of 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride?
5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride has a molecular weight of 325.80 g/mol, XLogP of 4.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide;hydrochloride is sourced from PubChem (CID 5351320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).