5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid

C12H7N3O4 — CID 91128673

IUPAC5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid
SMILESO=C(O)c1nnc(C(=O)O)c2c1[nH]c1ccccc12
InChIInChI=1S/C12H7N3O4/c16-11(17)9-7-5-3-1-2-4-6(5)13-8(7)10(12(18)19)15-14-9/h1-4,13H,(H,16,17)(H,18,19)
InChIKeyQGZMDPMIOLUSKY-UHFFFAOYSA-N
MW257.21 g/mol
LogP1.51
Rot. Bonds2

About 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid

5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid (PubChem CID 91128673) has the molecular formula C12H7N3O4 and a molecular weight of 257.21 g/mol. Its IUPAC name is 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid.

Molecular Properties

Compound Name5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid
PubChem CID91128673
Molecular FormulaC12H7N3O4
Molecular Weight257.21 g/mol
Exact Mass257.04
IUPAC Name5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid
SMILESO=C(O)c1nnc(C(=O)O)c2c1[nH]c1ccccc12
InChIInChI=1S/C12H7N3O4/c16-11(17)9-7-5-3-1-2-4-6(5)13-8(7)10(12(18)19)15-14-9/h1-4,13H,(H,16,17)(H,18,19)
InChIKeyQGZMDPMIOLUSKY-UHFFFAOYSA-N
XLogP1.51
TPSA116.17 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.21
LogP ≤ 51.51
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid?
The IUPAC name of 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid (CID 91128673) is 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid.
What is the SMILES notation for 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid?
The canonical SMILES for 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid is O=C(O)c1nnc(C(=O)O)c2c1[nH]c1ccccc12.
What is the InChIKey of 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid?
The InChIKey is QGZMDPMIOLUSKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O4/c16-11(17)9-7-5-3-1-2-4-6(5)13-8(7)10(12(18)19)15-14-9/h1-4,13H,(H,16,17)(H,18,19).
What are the key properties of 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid?
5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid has a molecular weight of 257.21 g/mol, XLogP of 1.51, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid is sourced from PubChem (CID 91128673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).