C12H7N3O4 — CID 91128673
5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid (PubChem CID 91128673) has the molecular formula C12H7N3O4 and a molecular weight of 257.21 g/mol. Its IUPAC name is 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid.
| Compound Name | 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 91128673 |
| Molecular Formula | C12H7N3O4 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 5H-pyridazino[4,5-b]indole-1,4-dicarboxylic acid |
| SMILES | O=C(O)c1nnc(C(=O)O)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C12H7N3O4/c16-11(17)9-7-5-3-1-2-4-6(5)13-8(7)10(12(18)19)15-14-9/h1-4,13H,(H,16,17)(H,18,19) |
| InChIKey | QGZMDPMIOLUSKY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |