C22H24ClN5O2 — CID 134152658
2,11-dimethyl-N-[2-(methylcarbamoylamino)ethyl]-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide chloride (PubChem CID 134152658) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 2,11-dimethyl-N-[2-(methylcarbamoylamino)ethyl]-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide chloride.
| Compound Name | 2,11-dimethyl-N-[2-(methylcarbamoylamino)ethyl]-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide chloride |
|---|---|
| PubChem CID | 134152658 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2,11-dimethyl-N-[2-(methylcarbamoylamino)ethyl]-6H-pyrido[4,3-b]carbazol-2-ium-5-carboxamide chloride |
| SMILES | CNC(=O)NCCNC(=O)c1c2cc[n+](C)cc2c(C)c2c1[nH]c1ccccc12.[Cl-] |
| InChI | InChI=1S/C22H23N5O2.ClH/c1-13-16-12-27(3)11-8-14(16)19(21(28)24-9-10-25-22(29)23-2)20-18(13)15-6-4-5-7-17(15)26-20;/h4-8,11-12H,9-10H2,1-3H3,(H3,23,24,25,28,29);1H |
| InChIKey | PRYIAMQJZXHGAN-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|