C17H19N3O3 — CID 75369929
N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-methyl-1H-indole-3-carboxamide (PubChem CID 75369929) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-methyl-1H-indole-3-carboxamide.
| Compound Name | N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-methyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 75369929 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-methyl-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)NCCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C17H19N3O3/c1-11-16(12-5-2-3-6-13(12)19-11)17(23)18-9-4-10-20-14(21)7-8-15(20)22/h2-3,5-6,19H,4,7-10H2,1H3,(H,18,23) |
| InChIKey | LPSAHIFNOMVFHY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|