C20H20N4O — CID 25393465
2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-1H-indole-3-carboxamide (PubChem CID 25393465) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-1H-indole-3-carboxamide.
| Compound Name | 2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 25393465 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-methyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)NCCn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C20H20N4O/c1-13-19(15-7-3-4-8-16(15)22-13)20(25)21-11-12-24-14(2)23-17-9-5-6-10-18(17)24/h3-10,22H,11-12H2,1-2H3,(H,21,25) |
| InChIKey | QTMSAACVXBMLDV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |