C20H28N2O4+2 — CID 20661165
5-[4-[1-(5-hydroperoxypentyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]pentanoic acid (PubChem CID 20661165) has the molecular formula C20H28N2O4+2 and a molecular weight of 360.45 g/mol. Its IUPAC name is 5-[4-[1-(5-hydroperoxypentyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]pentanoic acid.
| Compound Name | 5-[4-[1-(5-hydroperoxypentyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 20661165 |
| Molecular Formula | C20H28N2O4+2 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 5-[4-[1-(5-hydroperoxypentyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCC[n+]1ccc(-c2cc[n+](CCCCCOO)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O4/c23-20(24)6-2-4-12-22-15-9-19(10-16-22)18-7-13-21(14-8-18)11-3-1-5-17-26-25/h7-10,13-16H,1-6,11-12,17H2/p+2 |
| InChIKey | RAMROSKJHRPXMA-UHFFFAOYSA-P |
| XLogP | 2.84 |
| TPSA | 74.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|