C37H38N2O4+2 — CID 102210616
6-[4-[1-[[3,5-bis(phenylmethoxy)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 102210616) has the molecular formula C37H38N2O4+2 and a molecular weight of 574.72 g/mol. Its IUPAC name is 6-[4-[1-[[3,5-bis(phenylmethoxy)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[4-[1-[[3,5-bis(phenylmethoxy)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 102210616 |
| Molecular Formula | C37H38N2O4+2 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 6-[4-[1-[[3,5-bis(phenylmethoxy)phenyl]methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCC[n+]1ccc(-c2cc[n+](Cc3cc(OCc4ccccc4)cc(OCc4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C37H37N2O4/c40-37(41)14-8-3-9-19-38-20-15-33(16-21-38)34-17-22-39(23-18-34)27-32-24-35(42-28-30-10-4-1-5-11-30)26-36(25-32)43-29-31-12-6-2-7-13-31/h1-2,4-7,10-13,15-18,20-26H,3,8-9,14,19,27-29H2/q+1/p+1 |
| InChIKey | DKIWVOUJAAUREH-UHFFFAOYSA-O |
| XLogP | 6.78 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|