C40H38N4O2+2 — CID 121289791
6-[4-[4-[6-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 121289791) has the molecular formula C40H38N4O2+2 and a molecular weight of 606.77 g/mol. Its IUPAC name is 6-[4-[4-[6-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[4-[4-[6-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 121289791 |
| Molecular Formula | C40H38N4O2+2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 6-[4-[4-[6-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | CC[n+]1ccc(-c2ccc(-c3cc(-c4ccc(-c5cc[n+](CCCCCC(=O)O)cc5)cc4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C40H37N4O2/c1-2-43-25-20-32(21-26-43)30-12-16-34(17-13-30)37-29-38(42-40(41-37)36-9-5-3-6-10-36)35-18-14-31(15-19-35)33-22-27-44(28-23-33)24-8-4-7-11-39(45)46/h3,5-6,9-10,12-23,25-29H,2,4,7-8,11,24H2,1H3/q+1/p+1 |
| InChIKey | HOOWJFLUQAVBSN-UHFFFAOYSA-O |
| XLogP | 8.05 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|