C24H26N2O3 — CID 10318241
6-[[4-[4-(methylamino)phenyl]-6-phenyl-2-pyridinyl]oxy]hexanoic acid (PubChem CID 10318241) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 6-[[4-[4-(methylamino)phenyl]-6-phenyl-2-pyridinyl]oxy]hexanoic acid.
| Compound Name | 6-[[4-[4-(methylamino)phenyl]-6-phenyl-2-pyridinyl]oxy]hexanoic acid |
|---|---|
| PubChem CID | 10318241 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 6-[[4-[4-(methylamino)phenyl]-6-phenyl-2-pyridinyl]oxy]hexanoic acid |
| SMILES | CNc1ccc(-c2cc(OCCCCCC(=O)O)nc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-25-21-13-11-18(12-14-21)20-16-22(19-8-4-2-5-9-19)26-23(17-20)29-15-7-3-6-10-24(27)28/h2,4-5,8-9,11-14,16-17,25H,3,6-7,10,15H2,1H3,(H,27,28) |
| InChIKey | PGYDTYLUNVVWMR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|