C30H31N3O4 — CID 10051576
7-[4-[(4-phenyl-6-phenylmethoxypyrimidin-2-yl)amino]phenoxy]heptanoic acid (PubChem CID 10051576) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is 7-[4-[(4-phenyl-6-phenylmethoxypyrimidin-2-yl)amino]phenoxy]heptanoic acid.
| Compound Name | 7-[4-[(4-phenyl-6-phenylmethoxypyrimidin-2-yl)amino]phenoxy]heptanoic acid |
|---|---|
| PubChem CID | 10051576 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 7-[4-[(4-phenyl-6-phenylmethoxypyrimidin-2-yl)amino]phenoxy]heptanoic acid |
| SMILES | O=C(O)CCCCCCOc1ccc(Nc2nc(OCc3ccccc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C30H31N3O4/c34-29(35)15-9-1-2-10-20-36-26-18-16-25(17-19-26)31-30-32-27(24-13-7-4-8-14-24)21-28(33-30)37-22-23-11-5-3-6-12-23/h3-8,11-14,16-19,21H,1-2,9-10,15,20,22H2,(H,34,35)(H,31,32,33) |
| InChIKey | OMSAMZAERKMHGW-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|