C25H27N3O6 — CID 10367223
7-[4-[[4-(carboxymethoxy)-6-phenylpyrimidin-2-yl]amino]phenoxy]heptanoic acid (PubChem CID 10367223) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is 7-[4-[[4-(carboxymethoxy)-6-phenylpyrimidin-2-yl]amino]phenoxy]heptanoic acid.
| Compound Name | 7-[4-[[4-(carboxymethoxy)-6-phenylpyrimidin-2-yl]amino]phenoxy]heptanoic acid |
|---|---|
| PubChem CID | 10367223 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 7-[4-[[4-(carboxymethoxy)-6-phenylpyrimidin-2-yl]amino]phenoxy]heptanoic acid |
| SMILES | O=C(O)CCCCCCOc1ccc(Nc2nc(OCC(=O)O)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H27N3O6/c29-23(30)10-6-1-2-7-15-33-20-13-11-19(12-14-20)26-25-27-21(18-8-4-3-5-9-18)16-22(28-25)34-17-24(31)32/h3-5,8-9,11-14,16H,1-2,6-7,10,15,17H2,(H,29,30)(H,31,32)(H,26,27,28) |
| InChIKey | HVTFAGREWDVWAQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|