C30H31N3O4S — CID 59078044
N-[4-(aminomethyl)phenyl]sulfonyl-6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide (PubChem CID 59078044) has the molecular formula C30H31N3O4S and a molecular weight of 529.66 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]sulfonyl-6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide.
| Compound Name | N-[4-(aminomethyl)phenyl]sulfonyl-6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide |
|---|---|
| PubChem CID | 59078044 |
| Molecular Formula | C30H31N3O4S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]sulfonyl-6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanamide |
| SMILES | NCc1ccc(S(=O)(=O)NC(=O)CCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C30H31N3O4S/c31-22-23-15-17-27(18-16-23)38(35,36)33-29(34)14-8-3-9-19-37-30-21-26(24-10-4-1-5-11-24)20-28(32-30)25-12-6-2-7-13-25/h1-2,4-7,10-13,15-18,20-21H,3,8-9,14,19,22,31H2,(H,33,34) |
| InChIKey | PXWSGVDBEBRRIO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|