C26H30N2O3 — CID 10341972
ethyl 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2-methylhexanoate (PubChem CID 10341972) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is ethyl 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2-methylhexanoate.
| Compound Name | ethyl 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2-methylhexanoate |
|---|---|
| PubChem CID | 10341972 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | ethyl 6-[[4-(4-aminophenyl)-6-phenyl-2-pyridinyl]oxy]-2-methylhexanoate |
| SMILES | CCOC(=O)C(C)CCCCOc1cc(-c2ccc(N)cc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H30N2O3/c1-3-30-26(29)19(2)9-7-8-16-31-25-18-22(20-12-14-23(27)15-13-20)17-24(28-25)21-10-5-4-6-11-21/h4-6,10-15,17-19H,3,7-9,16,27H2,1-2H3 |
| InChIKey | IHVSVSBMFIITEK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|