C35H37N3O7 — CID 23501694
4-[amino-[1-carboxy-2-[2-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]phenyl]ethyl]amino]-4-oxobutanoic acid (PubChem CID 23501694) has the molecular formula C35H37N3O7 and a molecular weight of 611.70 g/mol. Its IUPAC name is 4-[amino-[1-carboxy-2-[2-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]phenyl]ethyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[amino-[1-carboxy-2-[2-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]phenyl]ethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 23501694 |
| Molecular Formula | C35H37N3O7 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | 4-[amino-[1-carboxy-2-[2-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]phenyl]ethyl]amino]-4-oxobutanoic acid |
| SMILES | NN(C(=O)CCC(=O)O)C(Cc1ccccc1OCCCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C35H37N3O7/c36-38(33(39)18-19-34(40)41)30(35(42)43)23-27-16-8-9-17-31(27)44-20-10-3-11-21-45-32-24-28(25-12-4-1-5-13-25)22-29(37-32)26-14-6-2-7-15-26/h1-2,4-9,12-17,22,24,30H,3,10-11,18-21,23,36H2,(H,40,41)(H,42,43) |
| InChIKey | ILWOZCWHWRDNPS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 152.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|