C40H47NO7 — CID 91092555
tert-butyl 4-[3-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate (PubChem CID 91092555) has the molecular formula C40H47NO7 and a molecular weight of 653.82 g/mol. Its IUPAC name is tert-butyl 4-[3-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate.
| Compound Name | tert-butyl 4-[3-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate |
|---|---|
| PubChem CID | 91092555 |
| Molecular Formula | C40H47NO7 |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.34 |
| IUPAC Name | tert-butyl 4-[3-[5-[(4,6-diphenyl-2-pyridinyl)oxy]pentoxy]-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate |
| SMILES | COC(=O)CCc1c(OCCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)n2)cccc1OCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H47NO7/c1-40(2,3)48-39(43)22-15-27-46-36-21-14-20-35(33(36)23-24-38(42)44-4)45-25-12-7-13-26-47-37-29-32(30-16-8-5-9-17-30)28-34(41-37)31-18-10-6-11-19-31/h5-6,8-11,14,16-21,28-29H,7,12-13,15,22-27H2,1-4H3 |
| InChIKey | UGGYUYLVCJCGHY-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|