C36H48O8 — CID 22089212
tert-butyl 4-[2-(3-methoxy-3-oxopropyl)-3-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentoxy]phenoxy]butanoate (PubChem CID 22089212) has the molecular formula C36H48O8 and a molecular weight of 608.77 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-methoxy-3-oxopropyl)-3-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentoxy]phenoxy]butanoate.
| Compound Name | tert-butyl 4-[2-(3-methoxy-3-oxopropyl)-3-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentoxy]phenoxy]butanoate |
|---|---|
| PubChem CID | 22089212 |
| Molecular Formula | C36H48O8 |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | tert-butyl 4-[2-(3-methoxy-3-oxopropyl)-3-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentoxy]phenoxy]butanoate |
| SMILES | C=CCc1c(OCCCCCOc2cccc(OCCCC(=O)OC(C)(C)C)c2CCC(=O)OC)ccc2c1CCCC2=O |
| InChI | InChI=1S/C36H48O8/c1-6-13-28-26-14-10-15-30(37)27(26)19-21-33(28)42-24-9-7-8-23-41-31-16-11-17-32(29(31)20-22-34(38)40-5)43-25-12-18-35(39)44-36(2,3)4/h6,11,16-17,19,21H,1,7-10,12-15,18,20,22-25H2,2-5H3 |
| InChIKey | BYRFAPWMTFGSND-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|