C34H44O7 — CID 67592058
methyl 4-[1-methoxy-1-oxo-3-[2-[6-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]hexyl]phenyl]propan-2-yl]oxybutanoate (PubChem CID 67592058) has the molecular formula C34H44O7 and a molecular weight of 564.72 g/mol. Its IUPAC name is methyl 4-[1-methoxy-1-oxo-3-[2-[6-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]hexyl]phenyl]propan-2-yl]oxybutanoate.
| Compound Name | methyl 4-[1-methoxy-1-oxo-3-[2-[6-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]hexyl]phenyl]propan-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 67592058 |
| Molecular Formula | C34H44O7 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | methyl 4-[1-methoxy-1-oxo-3-[2-[6-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]hexyl]phenyl]propan-2-yl]oxybutanoate |
| SMILES | C=CCc1c(OCCCCCCc2ccccc2CC(OCCCC(=O)OC)C(=O)OC)ccc2c1CCCC2=O |
| InChI | InChI=1S/C34H44O7/c1-4-13-29-27-17-11-18-30(35)28(27)20-21-31(29)40-22-10-6-5-7-14-25-15-8-9-16-26(25)24-32(34(37)39-3)41-23-12-19-33(36)38-2/h4,8-9,15-16,20-21,32H,1,5-7,10-14,17-19,22-24H2,2-3H3 |
| InChIKey | VRLGITLFRNYWDB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|