C22H28N6O2 — CID 57265829
6-hydrazinyl-N-[3-[(5-hydrazinylidene-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]propyl]pyridine-3-carboxamide (PubChem CID 57265829) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 6-hydrazinyl-N-[3-[(5-hydrazinylidene-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]propyl]pyridine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-[3-[(5-hydrazinylidene-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57265829 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 6-hydrazinyl-N-[3-[(5-hydrazinylidene-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]propyl]pyridine-3-carboxamide |
| SMILES | C=CCc1c(OCCCNC(=O)c2ccc(NN)nc2)ccc2c1CCCC2=NN |
| InChI | InChI=1S/C22H28N6O2/c1-2-5-18-16-6-3-7-19(27-23)17(16)9-10-20(18)30-13-4-12-25-22(29)15-8-11-21(28-24)26-14-15/h2,8-11,14H,1,3-7,12-13,23-24H2,(H,25,29)(H,26,28) |
| InChIKey | BBDSFCYMGJIRIS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|