C30H32N4O6S — CID 91277947
N-[4-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]butyl]-6-[[2-(trioxidanylsulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide (PubChem CID 91277947) has the molecular formula C30H32N4O6S and a molecular weight of 576.68 g/mol. Its IUPAC name is N-[4-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]butyl]-6-[[2-(trioxidanylsulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]butyl]-6-[[2-(trioxidanylsulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91277947 |
| Molecular Formula | C30H32N4O6S |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | N-[4-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]butyl]-6-[[2-(trioxidanylsulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide |
| SMILES | C=CCc1c(OCCCCNC(=O)c2ccc(/N=N/Cc3ccccc3SOOO)nc2)ccc2c1CCCC2=O |
| InChI | InChI=1S/C30H32N4O6S/c1-2-8-25-23-10-7-11-26(35)24(23)14-15-27(25)38-18-6-5-17-31-30(36)22-13-16-29(32-19-22)34-33-20-21-9-3-4-12-28(21)41-40-39-37/h2-4,9,12-16,19,37H,1,5-8,10-11,17-18,20H2,(H,31,36)/b34-33+ |
| InChIKey | BQCKDYNVQZPTOR-JEIPZWNWSA-N |
| XLogP | 6.63 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|