C24H35N5O7S — CID 90688332
2-[[[5-[3-[2-[2-[3-(methylamino)propoxy]ethoxy]ethoxy]propylcarbamoyl]-2-pyridinyl]diazenyl]methyl]benzenesulfonic acid (PubChem CID 90688332) has the molecular formula C24H35N5O7S and a molecular weight of 537.64 g/mol. Its IUPAC name is 2-[[[5-[3-[2-[2-[3-(methylamino)propoxy]ethoxy]ethoxy]propylcarbamoyl]-2-pyridinyl]diazenyl]methyl]benzenesulfonic acid.
| Compound Name | 2-[[[5-[3-[2-[2-[3-(methylamino)propoxy]ethoxy]ethoxy]propylcarbamoyl]-2-pyridinyl]diazenyl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 90688332 |
| Molecular Formula | C24H35N5O7S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 2-[[[5-[3-[2-[2-[3-(methylamino)propoxy]ethoxy]ethoxy]propylcarbamoyl]-2-pyridinyl]diazenyl]methyl]benzenesulfonic acid |
| SMILES | CNCCCOCCOCCOCCCNC(=O)c1ccc(/N=N/Cc2ccccc2S(=O)(=O)O)nc1 |
| InChI | InChI=1S/C24H35N5O7S/c1-25-10-4-12-34-14-16-36-17-15-35-13-5-11-26-24(30)21-8-9-23(27-18-21)29-28-19-20-6-2-3-7-22(20)37(31,32)33/h2-3,6-9,18,25H,4-5,10-17,19H2,1H3,(H,26,30)(H,31,32,33)/b29-28+ |
| InChIKey | WADAOZRBYNOPMC-ZQHSETAFSA-N |
| XLogP | 2.39 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|