C13H12N4O4S — CID 90975639
2-[[(5-carbamoyl-2-pyridinyl)diazenyl]methyl]benzenesulfonic acid (PubChem CID 90975639) has the molecular formula C13H12N4O4S and a molecular weight of 320.33 g/mol. Its IUPAC name is 2-[[(5-carbamoyl-2-pyridinyl)diazenyl]methyl]benzenesulfonic acid.
| Compound Name | 2-[[(5-carbamoyl-2-pyridinyl)diazenyl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 90975639 |
| Molecular Formula | C13H12N4O4S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-[[(5-carbamoyl-2-pyridinyl)diazenyl]methyl]benzenesulfonic acid |
| SMILES | NC(=O)c1ccc(/N=N/Cc2ccccc2S(=O)(=O)O)nc1 |
| InChI | InChI=1S/C13H12N4O4S/c14-13(18)10-5-6-12(15-7-10)17-16-8-9-3-1-2-4-11(9)22(19,20)21/h1-7H,8H2,(H2,14,18)(H,19,20,21)/b17-16+ |
| InChIKey | GOAGFYKRSGUHIJ-WUKNDPDISA-N |
| XLogP | 1.71 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|