C31H36N4O6S — CID 91067983
N-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentyl]-6-[[2-(trihydroxy-λ4-sulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide (PubChem CID 91067983) has the molecular formula C31H36N4O6S and a molecular weight of 592.72 g/mol. Its IUPAC name is N-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentyl]-6-[[2-(trihydroxy-λ4-sulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide.
| Compound Name | N-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentyl]-6-[[2-(trihydroxy-λ4-sulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91067983 |
| Molecular Formula | C31H36N4O6S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | N-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentyl]-6-[[2-(trihydroxy-λ4-sulfanyl)phenyl]methyldiazenyl]pyridine-3-carboxamide |
| SMILES | C=CCc1c(OCCCCCNC(=O)c2ccc(/N=N/Cc3ccccc3S(O)(O)O)nc2)ccc2c1CCCC2=O |
| InChI | InChI=1S/C31H36N4O6S/c1-2-9-26-24-11-8-12-27(36)25(24)15-16-28(26)41-19-7-3-6-18-32-31(37)23-14-17-30(33-20-23)35-34-21-22-10-4-5-13-29(22)42(38,39)40/h2,4-5,10,13-17,20,38-40H,1,3,6-9,11-12,18-19,21H2,(H,32,37)/b35-34+ |
| InChIKey | NCZJALQJELEMQI-XAHDOWKMSA-N |
| XLogP | 7.17 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|