C33H39N3O6S — CID 142139695
2-ethenylbenzenesulfonic acid;6-(methylamino)-N-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentyl]pyridine-3-carboxamide (PubChem CID 142139695) has the molecular formula C33H39N3O6S and a molecular weight of 605.76 g/mol. Its IUPAC name is 2-ethenylbenzenesulfonic acid;6-(methylamino)-N-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentyl]pyridine-3-carboxamide.
| Compound Name | 2-ethenylbenzenesulfonic acid;6-(methylamino)-N-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142139695 |
| Molecular Formula | C33H39N3O6S |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 2-ethenylbenzenesulfonic acid;6-(methylamino)-N-[5-[(5-oxo-1-prop-2-enyl-7,8-dihydro-6H-naphthalen-2-yl)oxy]pentyl]pyridine-3-carboxamide |
| SMILES | C=CCc1c(OCCCCCNC(=O)c2ccc(NC)nc2)ccc2c1CCCC2=O.C=Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C25H31N3O3.C8H8O3S/c1-3-8-21-19-9-7-10-22(29)20(19)12-13-23(21)31-16-6-4-5-15-27-25(30)18-11-14-24(26-2)28-17-18;1-2-7-5-3-4-6-8(7)12(9,10)11/h3,11-14,17H,1,4-10,15-16H2,2H3,(H,26,28)(H,27,30);2-6H,1H2,(H,9,10,11) |
| InChIKey | BDKYZHUGLLAMCI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|