C25H35N7O6S — CID 90980141
2-[[[5-[[6-[2-[(2R)-2-amino-4-methylpentanoyl]hydrazinyl]-6-oxohexyl]carbamoyl]-2-pyridinyl]diazenyl]methyl]benzenesulfonic acid (PubChem CID 90980141) has the molecular formula C25H35N7O6S and a molecular weight of 561.67 g/mol. Its IUPAC name is 2-[[[5-[[6-[2-[(2R)-2-amino-4-methylpentanoyl]hydrazinyl]-6-oxohexyl]carbamoyl]-2-pyridinyl]diazenyl]methyl]benzenesulfonic acid.
| Compound Name | 2-[[[5-[[6-[2-[(2R)-2-amino-4-methylpentanoyl]hydrazinyl]-6-oxohexyl]carbamoyl]-2-pyridinyl]diazenyl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 90980141 |
| Molecular Formula | C25H35N7O6S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | 2-[[[5-[[6-[2-[(2R)-2-amino-4-methylpentanoyl]hydrazinyl]-6-oxohexyl]carbamoyl]-2-pyridinyl]diazenyl]methyl]benzenesulfonic acid |
| SMILES | CC(C)C[C@@H](N)C(=O)NNC(=O)CCCCCNC(=O)c1ccc(/N=N/Cc2ccccc2S(=O)(=O)O)nc1 |
| InChI | InChI=1S/C25H35N7O6S/c1-17(2)14-20(26)25(35)32-31-23(33)10-4-3-7-13-27-24(34)19-11-12-22(28-15-19)30-29-16-18-8-5-6-9-21(18)39(36,37)38/h5-6,8-9,11-12,15,17,20H,3-4,7,10,13-14,16,26H2,1-2H3,(H,27,34)(H,31,33)(H,32,35)(H,36,37,38)/b30-29+/t20-/m1/s1 |
| InChIKey | XTZDLHSMPMVWCA-BKWYIPCTSA-N |
| XLogP | 2.42 |
| TPSA | 205.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|