C19H24N6O5S — CID 173214794
2-[[[5-[[[(2S)-2-amino-4-methylpentanoyl]amino]carbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid (PubChem CID 173214794) has the molecular formula C19H24N6O5S and a molecular weight of 448.51 g/mol. Its IUPAC name is 2-[[[5-[[[(2S)-2-amino-4-methylpentanoyl]amino]carbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid.
| Compound Name | 2-[[[5-[[[(2S)-2-amino-4-methylpentanoyl]amino]carbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173214794 |
| Molecular Formula | C19H24N6O5S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-[[[5-[[[(2S)-2-amino-4-methylpentanoyl]amino]carbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid |
| SMILES | CC(C)C[C@H](N)C(=O)NNC(=O)c1ccc(NN=Cc2ccccc2S(=O)(=O)O)nc1 |
| InChI | InChI=1S/C19H24N6O5S/c1-12(2)9-15(20)19(27)25-24-18(26)14-7-8-17(21-10-14)23-22-11-13-5-3-4-6-16(13)31(28,29)30/h3-8,10-12,15H,9,20H2,1-2H3,(H,21,23)(H,24,26)(H,25,27)(H,28,29,30)/t15-/m0/s1 |
| InChIKey | CYMGYAZCWFKTSS-HNNXBMFYSA-N |
| XLogP | 0.91 |
| TPSA | 175.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|