C22H22N6O5S — CID 91361297
2-[(Z)-[[5-[[4-(methylaminocarbamoyl)phenyl]methylcarbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid (PubChem CID 91361297) has the molecular formula C22H22N6O5S and a molecular weight of 482.52 g/mol. Its IUPAC name is 2-[(Z)-[[5-[[4-(methylaminocarbamoyl)phenyl]methylcarbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid.
| Compound Name | 2-[(Z)-[[5-[[4-(methylaminocarbamoyl)phenyl]methylcarbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 91361297 |
| Molecular Formula | C22H22N6O5S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-[(Z)-[[5-[[4-(methylaminocarbamoyl)phenyl]methylcarbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid |
| SMILES | CNNC(=O)c1ccc(CNC(=O)c2ccc(N/N=C\c3ccccc3S(=O)(=O)O)nc2)cc1 |
| InChI | InChI=1S/C22H22N6O5S/c1-23-28-22(30)16-8-6-15(7-9-16)12-25-21(29)18-10-11-20(24-13-18)27-26-14-17-4-2-3-5-19(17)34(31,32)33/h2-11,13-14,23H,12H2,1H3,(H,24,27)(H,25,29)(H,28,30)(H,31,32,33)/b26-14- |
| InChIKey | XZQKKTBILYRDCC-WGARJPEWSA-N |
| XLogP | 1.57 |
| TPSA | 161.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|