C39H41N5O6S — CID 59078031
2-[(E)-[[5-[3-[[1-[3-[(4-methylphenyl)methyl]-2H-chromen-7-yl]cyclopentanecarbonyl]amino]propylcarbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid (PubChem CID 59078031) has the molecular formula C39H41N5O6S and a molecular weight of 707.85 g/mol. Its IUPAC name is 2-[(E)-[[5-[3-[[1-[3-[(4-methylphenyl)methyl]-2H-chromen-7-yl]cyclopentanecarbonyl]amino]propylcarbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid.
| Compound Name | 2-[(E)-[[5-[3-[[1-[3-[(4-methylphenyl)methyl]-2H-chromen-7-yl]cyclopentanecarbonyl]amino]propylcarbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59078031 |
| Molecular Formula | C39H41N5O6S |
| Molecular Weight | 707.85 g/mol |
| Exact Mass | 707.28 |
| IUPAC Name | 2-[(E)-[[5-[3-[[1-[3-[(4-methylphenyl)methyl]-2H-chromen-7-yl]cyclopentanecarbonyl]amino]propylcarbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid |
| SMILES | Cc1ccc(CC2=Cc3ccc(C4(C(=O)NCCCNC(=O)c5ccc(N/N=C/c6ccccc6S(=O)(=O)O)nc5)CCCC4)cc3OC2)cc1 |
| InChI | InChI=1S/C39H41N5O6S/c1-27-9-11-28(12-10-27)21-29-22-30-13-15-33(23-34(30)50-26-29)39(17-4-5-18-39)38(46)41-20-6-19-40-37(45)32-14-16-36(42-24-32)44-43-25-31-7-2-3-8-35(31)51(47,48)49/h2-3,7-16,22-25H,4-6,17-21,26H2,1H3,(H,40,45)(H,41,46)(H,42,44)(H,47,48,49)/b43-25+ |
| InChIKey | QLCASBOFFQVQMR-HYNHWIHPSA-N |
| XLogP | 5.85 |
| TPSA | 159.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.85 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|