C39H39N6O6PS — CID 59642072
2-[[[5-[[6-[(3-diphenylphosphanylbenzoyl)amino]-1-(methylamino)-1-oxohexan-2-yl]carbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid (PubChem CID 59642072) has the molecular formula C39H39N6O6PS and a molecular weight of 750.82 g/mol. Its IUPAC name is 2-[[[5-[[6-[(3-diphenylphosphanylbenzoyl)amino]-1-(methylamino)-1-oxohexan-2-yl]carbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid.
| Compound Name | 2-[[[5-[[6-[(3-diphenylphosphanylbenzoyl)amino]-1-(methylamino)-1-oxohexan-2-yl]carbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59642072 |
| Molecular Formula | C39H39N6O6PS |
| Molecular Weight | 750.82 g/mol |
| Exact Mass | 750.24 |
| IUPAC Name | 2-[[[5-[[6-[(3-diphenylphosphanylbenzoyl)amino]-1-(methylamino)-1-oxohexan-2-yl]carbamoyl]-2-pyridinyl]hydrazinylidene]methyl]benzenesulfonic acid |
| SMILES | CNC(=O)C(CCCCNC(=O)c1cccc(P(c2ccccc2)c2ccccc2)c1)NC(=O)c1ccc(NN=Cc2ccccc2S(=O)(=O)O)nc1 |
| InChI | InChI=1S/C39H39N6O6PS/c1-40-39(48)34(44-38(47)30-22-23-36(42-26-30)45-43-27-29-13-8-9-21-35(29)53(49,50)51)20-10-11-24-41-37(46)28-14-12-19-33(25-28)52(31-15-4-2-5-16-31)32-17-6-3-7-18-32/h2-9,12-19,21-23,25-27,34H,10-11,20,24H2,1H3,(H,40,48)(H,41,46)(H,42,45)(H,44,47)(H,49,50,51) |
| InChIKey | SLJOKBUBDJZMIC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 178.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.82 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|