C20H25N5O6S — CID 59034823
2-[(E)-[[5-[[(5S)-5-carboxy-5-(methylamino)pentyl]carbamoyl]-2-pyridinyl]azaniumyl]iminomethyl]benzenesulfonate (PubChem CID 59034823) has the molecular formula C20H25N5O6S and a molecular weight of 463.52 g/mol. Its IUPAC name is 2-[(E)-[[5-[[(5S)-5-carboxy-5-(methylamino)pentyl]carbamoyl]-2-pyridinyl]azaniumyl]iminomethyl]benzenesulfonate.
| Compound Name | 2-[(E)-[[5-[[(5S)-5-carboxy-5-(methylamino)pentyl]carbamoyl]-2-pyridinyl]azaniumyl]iminomethyl]benzenesulfonate |
|---|---|
| PubChem CID | 59034823 |
| Molecular Formula | C20H25N5O6S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 2-[(E)-[[5-[[(5S)-5-carboxy-5-(methylamino)pentyl]carbamoyl]-2-pyridinyl]azaniumyl]iminomethyl]benzenesulfonate |
| SMILES | CN[C@@H](CCCCNC(=O)c1ccc([NH2+]/N=C/c2ccccc2S(=O)(=O)[O-])nc1)C(=O)O |
| InChI | InChI=1S/C20H25N5O6S/c1-21-16(20(27)28)7-4-5-11-22-19(26)15-9-10-18(23-12-15)25-24-13-14-6-2-3-8-17(14)32(29,30)31/h2-3,6,8-10,12-13,16,21H,4-5,7,11H2,1H3,(H,22,26)(H,23,25)(H,27,28)(H,29,30,31)/b24-13+/t16-/m0/s1 |
| InChIKey | ZKWPAEPZPNQDTG-CBFMJHRQSA-N |
| XLogP | -0.21 |
| TPSA | 177.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|