C21H36N4O — CID 123241051
N-(8-methylundecyl)-6-(propan-2-yldiazenyl)pyridine-3-carboxamide (PubChem CID 123241051) has the molecular formula C21H36N4O and a molecular weight of 360.55 g/mol. Its IUPAC name is N-(8-methylundecyl)-6-(propan-2-yldiazenyl)pyridine-3-carboxamide.
| Compound Name | N-(8-methylundecyl)-6-(propan-2-yldiazenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123241051 |
| Molecular Formula | C21H36N4O |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | N-(8-methylundecyl)-6-(propan-2-yldiazenyl)pyridine-3-carboxamide |
| SMILES | CCCC(C)CCCCCCCNC(=O)c1ccc(/N=N/C(C)C)nc1 |
| InChI | InChI=1S/C21H36N4O/c1-5-11-18(4)12-9-7-6-8-10-15-22-21(26)19-13-14-20(23-16-19)25-24-17(2)3/h13-14,16-18H,5-12,15H2,1-4H3,(H,22,26)/b25-24+ |
| InChIKey | QFEKDIGTZUYMRK-OCOZRVBESA-N |
| XLogP | 6.08 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|