C20H28N4O7 — CID 91052286
2-[bis(carboxymethyl)amino]-6-[[4-(propan-2-yldiazenyl)benzoyl]amino]hexanoic acid (PubChem CID 91052286) has the molecular formula C20H28N4O7 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-[[4-(propan-2-yldiazenyl)benzoyl]amino]hexanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-[[4-(propan-2-yldiazenyl)benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 91052286 |
| Molecular Formula | C20H28N4O7 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-[[4-(propan-2-yldiazenyl)benzoyl]amino]hexanoic acid |
| SMILES | CC(C)/N=N/c1ccc(C(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C20H28N4O7/c1-13(2)22-23-15-8-6-14(7-9-15)19(29)21-10-4-3-5-16(20(30)31)24(11-17(25)26)12-18(27)28/h6-9,13,16H,3-5,10-12H2,1-2H3,(H,21,29)(H,25,26)(H,27,28)(H,30,31)/b23-22+ |
| InChIKey | LGWWFHDTNWBJMT-GHVJWSGMSA-N |
| XLogP | 2.00 |
| TPSA | 168.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|