C27H38N4O13 — CID 59906114
(2S)-2-[bis(carboxymethyl)amino]-6-[[3-[[(5S)-5-carboxy-5-[carboxymethyl(hydroxymethyl)amino]pentyl]carbamoyl]benzoyl]amino]hexanoic acid (PubChem CID 59906114) has the molecular formula C27H38N4O13 and a molecular weight of 626.62 g/mol. Its IUPAC name is (2S)-2-[bis(carboxymethyl)amino]-6-[[3-[[(5S)-5-carboxy-5-[carboxymethyl(hydroxymethyl)amino]pentyl]carbamoyl]benzoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[bis(carboxymethyl)amino]-6-[[3-[[(5S)-5-carboxy-5-[carboxymethyl(hydroxymethyl)amino]pentyl]carbamoyl]benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 59906114 |
| Molecular Formula | C27H38N4O13 |
| Molecular Weight | 626.62 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | (2S)-2-[bis(carboxymethyl)amino]-6-[[3-[[(5S)-5-carboxy-5-[carboxymethyl(hydroxymethyl)amino]pentyl]carbamoyl]benzoyl]amino]hexanoic acid |
| SMILES | O=C(O)CN(CO)[C@@H](CCCCNC(=O)c1cccc(C(=O)NCCCC[C@@H](C(=O)O)N(CC(=O)O)CC(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C27H38N4O13/c32-16-31(15-23(37)38)20(27(43)44)9-2-4-11-29-25(40)18-7-5-6-17(12-18)24(39)28-10-3-1-8-19(26(41)42)30(13-21(33)34)14-22(35)36/h5-7,12,19-20,32H,1-4,8-11,13-16H2,(H,28,39)(H,29,40)(H,33,34)(H,35,36)(H,37,38)(H,41,42)(H,43,44)/t19-,20-/m0/s1 |
| InChIKey | YIRADSQAZUYCHP-PMACEKPBSA-N |
| XLogP | -0.80 |
| TPSA | 271.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.62 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|