C19H27N5O7 — CID 58958801
2-[bis(carboxymethyl)amino]-6-[[6-(2-propan-2-ylidenehydrazinyl)pyridine-3-carbonyl]amino]hexanoic acid (PubChem CID 58958801) has the molecular formula C19H27N5O7 and a molecular weight of 437.45 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-[[6-(2-propan-2-ylidenehydrazinyl)pyridine-3-carbonyl]amino]hexanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-[[6-(2-propan-2-ylidenehydrazinyl)pyridine-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 58958801 |
| Molecular Formula | C19H27N5O7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-[[6-(2-propan-2-ylidenehydrazinyl)pyridine-3-carbonyl]amino]hexanoic acid |
| SMILES | CC(C)=NNc1ccc(C(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O)cn1 |
| InChI | InChI=1S/C19H27N5O7/c1-12(2)22-23-15-7-6-13(9-21-15)18(29)20-8-4-3-5-14(19(30)31)24(10-16(25)26)11-17(27)28/h6-7,9,14H,3-5,8,10-11H2,1-2H3,(H,20,29)(H,21,23)(H,25,26)(H,27,28)(H,30,31) |
| InChIKey | RIIPBTKJJYBQMT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 181.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|