C36H53N5O12 — CID 169048356
6-[[2-[2-[2-[2-[4-[[4-(6-aminohexoxy)phenyl]diazenyl]phenoxy]ethoxy]ethoxy]ethoxy]acetyl]amino]-2-[bis(carboxymethyl)amino]hexanoic acid (PubChem CID 169048356) has the molecular formula C36H53N5O12 and a molecular weight of 747.84 g/mol. Its IUPAC name is 6-[[2-[2-[2-[2-[4-[[4-(6-aminohexoxy)phenyl]diazenyl]phenoxy]ethoxy]ethoxy]ethoxy]acetyl]amino]-2-[bis(carboxymethyl)amino]hexanoic acid.
| Compound Name | 6-[[2-[2-[2-[2-[4-[[4-(6-aminohexoxy)phenyl]diazenyl]phenoxy]ethoxy]ethoxy]ethoxy]acetyl]amino]-2-[bis(carboxymethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 169048356 |
| Molecular Formula | C36H53N5O12 |
| Molecular Weight | 747.84 g/mol |
| Exact Mass | 747.37 |
| IUPAC Name | 6-[[2-[2-[2-[2-[4-[[4-(6-aminohexoxy)phenyl]diazenyl]phenoxy]ethoxy]ethoxy]ethoxy]acetyl]amino]-2-[bis(carboxymethyl)amino]hexanoic acid |
| SMILES | NCCCCCCOc1ccc(/N=N/c2ccc(OCCOCCOCCOCC(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C36H53N5O12/c37-16-4-1-2-6-18-52-30-12-8-28(9-13-30)39-40-29-10-14-31(15-11-29)53-24-23-50-20-19-49-21-22-51-27-33(42)38-17-5-3-7-32(36(47)48)41(25-34(43)44)26-35(45)46/h8-15,32H,1-7,16-27,37H2,(H,38,42)(H,43,44)(H,45,46)(H,47,48)/b40-39+ |
| InChIKey | RBAYLGAJWMRCCO-XQQUEIPISA-N |
| XLogP | 3.64 |
| TPSA | 241.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.84 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|