C39H52F2N2O13 — CID 155385212
2-[bis(carboxymethyl)amino]-6-[4,4-bis[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]pentanoylamino]hexanoic acid;dihydrofluoride (PubChem CID 155385212) has the molecular formula C39H52F2N2O13 and a molecular weight of 794.84 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-[4,4-bis[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]pentanoylamino]hexanoic acid;dihydrofluoride.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-[4,4-bis[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]pentanoylamino]hexanoic acid;dihydrofluoride |
|---|---|
| PubChem CID | 155385212 |
| Molecular Formula | C39H52F2N2O13 |
| Molecular Weight | 794.84 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-[4,4-bis[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]pentanoylamino]hexanoic acid;dihydrofluoride |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(C)(CCC(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O)c2ccc(OCCOC(=O)C(=C)C)cc2)cc1.F.F |
| InChI | InChI=1S/C39H50N2O13.2FH/c1-26(2)37(49)53-22-20-51-30-13-9-28(10-14-30)39(5,29-11-15-31(16-12-29)52-21-23-54-38(50)27(3)4)18-17-33(42)40-19-7-6-8-32(36(47)48)41(24-34(43)44)25-35(45)46;;/h9-16,32H,1,3,6-8,17-25H2,2,4-5H3,(H,40,42)(H,43,44)(H,45,46)(H,47,48);2*1H |
| InChIKey | COHNEZDDNPQIAC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 215.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|