C45H53N3O11 — CID 59537179
2-[4-[5-[bis[3-(3-hydroxy-2-oxo-1-pyridinyl)propyl]amino]-2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-oxopentan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 59537179) has the molecular formula C45H53N3O11 and a molecular weight of 811.93 g/mol. Its IUPAC name is 2-[4-[5-[bis[3-(3-hydroxy-2-oxo-1-pyridinyl)propyl]amino]-2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-oxopentan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[5-[bis[3-(3-hydroxy-2-oxo-1-pyridinyl)propyl]amino]-2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-oxopentan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59537179 |
| Molecular Formula | C45H53N3O11 |
| Molecular Weight | 811.93 g/mol |
| Exact Mass | 811.37 |
| IUPAC Name | 2-[4-[5-[bis[3-(3-hydroxy-2-oxo-1-pyridinyl)propyl]amino]-2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-5-oxopentan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(C)(CCC(=O)N(CCCn2cccc(O)c2=O)CCCn2cccc(O)c2=O)c2ccc(OCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C45H53N3O11/c1-32(2)43(54)58-30-28-56-36-16-12-34(13-17-36)45(5,35-14-18-37(19-15-35)57-29-31-59-44(55)33(3)4)21-20-40(51)46(24-8-26-47-22-6-10-38(49)41(47)52)25-9-27-48-23-7-11-39(50)42(48)53/h6-7,10-19,22-23,49-50H,1,3,8-9,20-21,24-31H2,2,4-5H3 |
| InChIKey | FLXBSZJALBIXBN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.93 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|