C35H46O9 — CID 142098798
2-butoxyethyl 4,4-bis[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]pentanoate (PubChem CID 142098798) has the molecular formula C35H46O9 and a molecular weight of 610.74 g/mol. Its IUPAC name is 2-butoxyethyl 4,4-bis[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]pentanoate.
| Compound Name | 2-butoxyethyl 4,4-bis[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]pentanoate |
|---|---|
| PubChem CID | 142098798 |
| Molecular Formula | C35H46O9 |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | 2-butoxyethyl 4,4-bis[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]pentanoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(C)(CCC(=O)OCCOCCCC)c2ccc(OCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C35H46O9/c1-7-8-19-39-20-21-42-32(36)17-18-35(6,28-9-13-30(14-10-28)40-22-24-43-33(37)26(2)3)29-11-15-31(16-12-29)41-23-25-44-34(38)27(4)5/h9-16H,2,4,7-8,17-25H2,1,3,5-6H3 |
| InChIKey | VRPBARKMLQCKOX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|