C39H59O7Sb — CID 142098800
2-[4-[6-dimethylstibanyl-2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]hexan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate;2-methyl-2-propan-2-yloxypropane (PubChem CID 142098800) has the molecular formula C39H59O7Sb and a molecular weight of 761.65 g/mol. Its IUPAC name is 2-[4-[6-dimethylstibanyl-2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]hexan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate;2-methyl-2-propan-2-yloxypropane.
| Compound Name | 2-[4-[6-dimethylstibanyl-2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]hexan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate;2-methyl-2-propan-2-yloxypropane |
|---|---|
| PubChem CID | 142098800 |
| Molecular Formula | C39H59O7Sb |
| Molecular Weight | 761.65 g/mol |
| Exact Mass | 760.33 |
| IUPAC Name | 2-[4-[6-dimethylstibanyl-2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]hexan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate;2-methyl-2-propan-2-yloxypropane |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(C)(CCCC[Sb](C)C)c2ccc(OCCOC(=O)C(=C)C)cc2)cc1.CC(C)OC(C)(C)C |
| InChI | InChI=1S/C30H37O6.C7H16O.2CH3.Sb/c1-7-8-17-30(6,24-9-13-26(14-10-24)33-18-20-35-28(31)22(2)3)25-11-15-27(16-12-25)34-19-21-36-29(32)23(4)5;1-6(2)8-7(3,4)5;;;/h9-16H,1-2,4,7-8,17-21H2,3,5-6H3;6H,1-5H3;2*1H3; |
| InChIKey | GYCURSHLOZGGSQ-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.65 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|