C21H25O7P — CID 54281039
2-[4-[2-(4-phosphonooxyphenyl)propan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 54281039) has the molecular formula C21H25O7P and a molecular weight of 420.40 g/mol. Its IUPAC name is 2-[4-[2-(4-phosphonooxyphenyl)propan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2-(4-phosphonooxyphenyl)propan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54281039 |
| Molecular Formula | C21H25O7P |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-[4-[2-(4-phosphonooxyphenyl)propan-2-yl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(C)(C)c2ccc(OP(=O)(O)O)cc2)cc1 |
| InChI | InChI=1S/C21H25O7P/c1-15(2)20(22)27-14-13-26-18-9-5-16(6-10-18)21(3,4)17-7-11-19(12-8-17)28-29(23,24)25/h5-12H,1,13-14H2,2-4H3,(H2,23,24,25) |
| InChIKey | RQUNBDFPEGQVTQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|