C37H38O6 — CID 134385835
2-[4-[[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-diphenylmethyl]phenoxy]ethyl 2-methylpropanoate (PubChem CID 134385835) has the molecular formula C37H38O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is 2-[4-[[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-diphenylmethyl]phenoxy]ethyl 2-methylpropanoate.
| Compound Name | 2-[4-[[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-diphenylmethyl]phenoxy]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 134385835 |
| Molecular Formula | C37H38O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 2-[4-[[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]-diphenylmethyl]phenoxy]ethyl 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(c2ccccc2)(c2ccccc2)c2ccc(OCCOC(=O)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H38O6/c1-27(2)35(38)42-25-23-40-33-19-15-31(16-20-33)37(29-11-7-5-8-12-29,30-13-9-6-10-14-30)32-17-21-34(22-18-32)41-24-26-43-36(39)28(3)4/h5-22,28H,1,23-26H2,2-4H3 |
| InChIKey | ZPGQAUZFPOAWAU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|