C21H41N3O10 — CID 21348390
methyl 6-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]-2-[(2-methoxy-2-oxoethyl)-(2-methylperoxyethyl)amino]hexanoate (PubChem CID 21348390) has the molecular formula C21H41N3O10 and a molecular weight of 495.57 g/mol. Its IUPAC name is methyl 6-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]-2-[(2-methoxy-2-oxoethyl)-(2-methylperoxyethyl)amino]hexanoate.
| Compound Name | methyl 6-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]-2-[(2-methoxy-2-oxoethyl)-(2-methylperoxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 21348390 |
| Molecular Formula | C21H41N3O10 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | methyl 6-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]-2-[(2-methoxy-2-oxoethyl)-(2-methylperoxyethyl)amino]hexanoate |
| SMILES | COOCCN(CC(=O)OC)C(CCCCNC(=O)COCCOCCOCCN)C(=O)OC |
| InChI | InChI=1S/C21H41N3O10/c1-28-20(26)16-24(9-11-34-30-3)18(21(27)29-2)6-4-5-8-23-19(25)17-33-15-14-32-13-12-31-10-7-22/h18H,4-17,22H2,1-3H3,(H,23,25) |
| InChIKey | OFKUVNPNCCTENA-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 157.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|