C29H38N4O8 — CID 101341384
methyl 6-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-[bis(2-oxo-2-phenylmethoxyethyl)amino]hexanoate (PubChem CID 101341384) has the molecular formula C29H38N4O8 and a molecular weight of 570.64 g/mol. Its IUPAC name is methyl 6-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-[bis(2-oxo-2-phenylmethoxyethyl)amino]hexanoate.
| Compound Name | methyl 6-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-[bis(2-oxo-2-phenylmethoxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 101341384 |
| Molecular Formula | C29H38N4O8 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | methyl 6-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-[bis(2-oxo-2-phenylmethoxyethyl)amino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)CNC(=O)CN)N(CC(=O)OCc1ccccc1)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H38N4O8/c1-39-29(38)24(14-8-9-15-31-26(35)17-32-25(34)16-30)33(18-27(36)40-20-22-10-4-2-5-11-22)19-28(37)41-21-23-12-6-3-7-13-23/h2-7,10-13,24H,8-9,14-21,30H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | QHAQKPLMIGPKEB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 166.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|