C12H20N2O8 — CID 176827256
2-[bis(carboxymethyl)amino]-6-[(2-hydroxyacetyl)amino]hexanoic acid (PubChem CID 176827256) has the molecular formula C12H20N2O8 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-[(2-hydroxyacetyl)amino]hexanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-[(2-hydroxyacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 176827256 |
| Molecular Formula | C12H20N2O8 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-[(2-hydroxyacetyl)amino]hexanoic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(CCCCNC(=O)CO)C(=O)O |
| InChI | InChI=1S/C12H20N2O8/c15-7-9(16)13-4-2-1-3-8(12(21)22)14(5-10(17)18)6-11(19)20/h8,15H,1-7H2,(H,13,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | XIMCNGVIWXQLEL-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|